CAS 1119452-71-9 appears in our catalog under these names: 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]benzoyl chloride, 95%, 3-(5-(Chloromethyl)-1,2,4-oxadiazol-3-yl)benzoyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoyl chloride (CAS 1119452-71-9) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoyl chloride. InChIKey: HJRGPUANWLVKTD-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoyl chloride |
| InChIKey | HJRGPUANWLVKTD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)Cl)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)