CAS 445302-10-3 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)-1H-imidazole-4-carboxylic acid, 98%, 1-(3,4-Dichlorophenyl)-1H-imidazole-4-carboxylic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg.
1-(3,4-dichlorophenyl)imidazole-4-carboxylic acid (CAS 445302-10-3) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)imidazole-4-carboxylic acid. InChIKey: FKYKLCCAVXYPJK-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)imidazole-4-carboxylic acid |
| InChIKey | FKYKLCCAVXYPJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C=C(N=C2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)