Products 20197-82-4
CAS 20197-82-4 is the registry number for 2,4-Dichloro-7,8-dihydro-[1,4]dioxino[2,3-g]quinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-7,8-dihydro-[1,4]dioxino[2,3-g]quinazoline (CAS 20197-82-4) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: 2,4-dichloro-7,8-dihydro-[1,4]dioxino[2,3-g]quinazoline. InChIKey: PBWQQMVFFDUFRO-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 2,4-dichloro-7,8-dihydro-[1,4]dioxino[2,3-g]quinazoline |
| InChIKey | PBWQQMVFFDUFRO-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C3C(=C2)N=C(N=C3Cl)Cl |
Computed by PubChem (NCBI)