CAS 1205542-49-9 is the registry number for Imidazole-1-carboxylic acid 3,4-dichloro-phenyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3,4-dichlorophenyl) imidazole-1-carboxylate (CAS 1205542-49-9) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: (3,4-dichlorophenyl) imidazole-1-carboxylate. InChIKey: UDKFKZHQEOZPSX-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | (3,4-dichlorophenyl) imidazole-1-carboxylate |
| InChIKey | UDKFKZHQEOZPSX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(=O)N2C=CN=C2)Cl)Cl |
Computed by PubChem (NCBI)