CAS 1870519-02-0 is the registry number for 1-(2,6-Dichloro-4-nitrophenyl)cyclopropane-1-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,6-dichloro-4-nitrophenyl)cyclopropane-1-carbonitrile (CAS 1870519-02-0) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: 1-(2,6-dichloro-4-nitrophenyl)cyclopropane-1-carbonitrile. InChIKey: GLSQPMRHKSCUPI-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 1-(2,6-dichloro-4-nitrophenyl)cyclopropane-1-carbonitrile |
| InChIKey | GLSQPMRHKSCUPI-UHFFFAOYSA-N |
| SMILES | C1CC1(C#N)C2=C(C=C(C=C2Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)