CAS 1152543-60-6 is the registry number for 5-(2,5-Dichlorophenyl)-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,5-dichlorophenyl)-1H-pyrazole-4-carboxylic acid (CAS 1152543-60-6) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: 5-(2,5-dichlorophenyl)-1H-pyrazole-4-carboxylic acid. InChIKey: MJJJDTAJXAHGOV-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 5-(2,5-dichlorophenyl)-1H-pyrazole-4-carboxylic acid |
| InChIKey | MJJJDTAJXAHGOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=C(C=NN2)C(=O)O)Cl |
Computed by PubChem (NCBI)