Products 1152543-60-6

CAS 1152543-60-6 is the registry number for 5-(2,5-Dichlorophenyl)-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(2,5-dichlorophenyl)-1H-pyrazole-4-carboxylic acid (CAS 1152543-60-6) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: 5-(2,5-dichlorophenyl)-1H-pyrazole-4-carboxylic acid. InChIKey: MJJJDTAJXAHGOV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6Cl2N2O2
Molecular weight257.07 g/mol
IUPAC name5-(2,5-dichlorophenyl)-1H-pyrazole-4-carboxylic acid
InChIKeyMJJJDTAJXAHGOV-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)C2=C(C=NN2)C(=O)O)Cl

Computed by PubChem (NCBI)