cas: 1416990-08-3 — see every product listed under this CAS number, including other names
3-(5-Hydroxy-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 95% (CAS 1416990-08-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | JD-4132-5g |
| cas | 1416990-08-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 500mg | 487.35 Pln | |
| Fluorochem | 1g | 763.29 Pln | |
| Fluorochem | 5g | 2939.61 Pln | |
| Fluorochem | 10g | 4662.96 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 1416990-08-3) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: JJUMFQGCQAUIFH-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | JJUMFQGCQAUIFH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)O |
Computed by PubChem (NCBI)