cas: 1416990-08-3 — see every product listed under this CAS number, including other names
3-(5-Hydroxy-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%, 98% (CAS 1416990-08-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JLUU-25g |
| cas | 1416990-08-3 |
| size | 25g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 4115.60 Pln | |
| Chemat | 50g | 5958.80 Pln | |
| Chemat | 100g | 9650.00 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 500mg | 309.20 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1782.80 Pln | |
| Chemat | 10g | 2819.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 1416990-08-3) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: JJUMFQGCQAUIFH-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | JJUMFQGCQAUIFH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)O |
Computed by PubChem (NCBI)