cas: 83907-40-8 — see every product listed under this CAS number, including other names
3-(6-Methoxyquinolin-1-ium-1-yl)propane-1-sulfonate, 98% (CAS 83907-40-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F869009-50MG |
| cas | 83907-40-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 529.00 Pln | |
| Fluorochem | 100mg | 825.77 Pln | |
| Fluorochem | 250mg | 1466.17 Pln | |
| Fluorochem | 1g | 3793.47 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(6-methoxyquinolin-1-ium-1-yl)propane-1-sulfonate (CAS 83907-40-8) is a chemical compound with the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. IUPAC name: 3-(6-methoxyquinolin-1-ium-1-yl)propane-1-sulfonate. InChIKey: ZVDGOJFPFMINBM-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | 3-(6-methoxyquinolin-1-ium-1-yl)propane-1-sulfonate |
| InChIKey | ZVDGOJFPFMINBM-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)[N+](=CC=C2)CCCS(=O)(=O)[O-] |
Computed by PubChem (NCBI)