Products 352523-83-2
CAS 352523-83-2 is the registry number for 4-(Cyclohexylthio)-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-cyclohexylsulfanyl-3-nitrobenzoic acid (CAS 352523-83-2) is a chemical compound with the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. IUPAC name: 4-cyclohexylsulfanyl-3-nitrobenzoic acid. InChIKey: QBNAVGCTRZCBGQ-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | 4-cyclohexylsulfanyl-3-nitrobenzoic acid |
| InChIKey | QBNAVGCTRZCBGQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)SC2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-(cyclohexylthio)-3-nitrobenzoic acid, 4-(cyclohexylsulfanyl)-3-nitrobenzoic acid, 4-cyclohexylsulfanyl-3-nitrobenzoic acid, benzoic acid, 4-(cyclohexylthio)-3-nitro-, 4-cyclohexylthio-3-nitrobenzoic acid, 4-cyclohexylsulfanyl-3-nitro-benzoic Acid, Oprea1_765932, 4-(cyclohexylthio)-3-nitrobenzoicacid