CAS 1321889-46-6 is the registry number for 1,4-Diethoxy-1,4-dioxo-3-(pyridin-1-ium-1-yl)but-2-ene-2-thiolate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-diethoxy-1,4-dioxo-3-pyridin-1-ium-1-ylbut-2-ene-2-thiolate (CAS 1321889-46-6) is a chemical compound with the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. IUPAC name: 1,4-diethoxy-1,4-dioxo-3-pyridin-1-ium-1-ylbut-2-ene-2-thiolate. InChIKey: USKOASNUVCXZHD-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | 1,4-diethoxy-1,4-dioxo-3-pyridin-1-ium-1-ylbut-2-ene-2-thiolate |
| InChIKey | USKOASNUVCXZHD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C(C(=O)OCC)[S-])[N+]1=CC=CC=C1 |
Computed by PubChem (NCBI)