CAS 2792143-71-4 is the registry number for (3-Oxo-2-azabicyclo[2.1.1]hexan-1-yl)methyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-oxo-2-azabicyclo[2.1.1]hexan-1-yl)methyl 4-methylbenzenesulfonate (CAS 2792143-71-4) is a chemical compound with the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. IUPAC name: (3-oxo-2-azabicyclo[2.1.1]hexan-1-yl)methyl 4-methylbenzenesulfonate. InChIKey: GDRLUQAWRVFYKX-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | (3-oxo-2-azabicyclo[2.1.1]hexan-1-yl)methyl 4-methylbenzenesulfonate |
| InChIKey | GDRLUQAWRVFYKX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC23CC(C2)C(=O)N3 |
Computed by PubChem (NCBI)