Products 379242-90-7
CAS 379242-90-7 is the registry number for Methyl 2-(3-oxobutanamido)-4H,5H,6H-cyclopenta(b)thiophene-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 2-(3-oxobutanoylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (CAS 379242-90-7) is a chemical compound with the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. IUPAC name: methyl 2-(3-oxobutanoylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate. InChIKey: FNBRBRMSLJIFTR-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | methyl 2-(3-oxobutanoylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| InChIKey | FNBRBRMSLJIFTR-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC1=C(C2=C(S1)CCC2)C(=O)OC |
Computed by PubChem (NCBI)