Products 1312077-04-5
CAS 1312077-04-5 appears in our catalog under these names: Rasagiline Impurity 5 Mesylate, 3-(prop-2-yn-1-ylamino)-2,3-dihydro-1H-inden-1-one methanesulfonate, Rasagiline Impurity 9, 3-N-Propargylaminoindan-1-one Mesylate. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methanesulfonic acid;3-(prop-2-ynylamino)-2,3-dihydroinden-1-one (CAS 1312077-04-5) is a chemical compound with the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. IUPAC name: methanesulfonic acid;3-(prop-2-ynylamino)-2,3-dihydroinden-1-one. InChIKey: VYZWTCVNAWAITD-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | methanesulfonic acid;3-(prop-2-ynylamino)-2,3-dihydroinden-1-one |
| InChIKey | VYZWTCVNAWAITD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C#CCNC1CC(=O)C2=CC=CC=C12 |
Computed by PubChem (NCBI)