Products 1201594-33-3

CAS 1201594-33-3 is the registry number for 4-Methoxy-1-naphthalenylN,N-dimethylsulfamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

(4-methoxynaphthalen-1-yl) N,N-dimethylsulfamate (CAS 1201594-33-3) is a chemical compound with the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. IUPAC name: (4-methoxynaphthalen-1-yl) N,N-dimethylsulfamate. InChIKey: DPPRXGQTZOFSQO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO4S
Molecular weight281.33 g/mol
IUPAC name(4-methoxynaphthalen-1-yl) N,N-dimethylsulfamate
InChIKeyDPPRXGQTZOFSQO-UHFFFAOYSA-N
SMILESCN(C)S(=O)(=O)OC1=CC=C(C2=CC=CC=C21)OC

Computed by PubChem (NCBI)