CAS 1201594-33-3 is the registry number for 4-Methoxy-1-naphthalenylN,N-dimethylsulfamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
(4-methoxynaphthalen-1-yl) N,N-dimethylsulfamate (CAS 1201594-33-3) is a chemical compound with the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. IUPAC name: (4-methoxynaphthalen-1-yl) N,N-dimethylsulfamate. InChIKey: DPPRXGQTZOFSQO-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | (4-methoxynaphthalen-1-yl) N,N-dimethylsulfamate |
| InChIKey | DPPRXGQTZOFSQO-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)OC1=CC=C(C2=CC=CC=C21)OC |
Computed by PubChem (NCBI)