CAS 2716176-21-3 is the registry number for (2,5-Dimethyloxazol-4-yl)methyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,5-dimethyl-1,3-oxazol-4-yl)methyl 4-methylbenzenesulfonate (CAS 2716176-21-3) is a chemical compound with the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. IUPAC name: (2,5-dimethyl-1,3-oxazol-4-yl)methyl 4-methylbenzenesulfonate. InChIKey: MTBUCIWMUKKFHN-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | (2,5-dimethyl-1,3-oxazol-4-yl)methyl 4-methylbenzenesulfonate |
| InChIKey | MTBUCIWMUKKFHN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2=C(OC(=N2)C)C |
Computed by PubChem (NCBI)