cas: 1173081-96-3 — see every product listed under this CAS number, including other names
3-(Aminomethyl)-4,6-dimethylpyridin-2(1H)-one hydrochloride 95% (CAS 1173081-96-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A714837-250mg |
| cas | 1173081-96-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 381.50 Pln | |
| Ambeed | 25g | 487.19 Pln | |
| Ambeed | 100g | 1277.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A714837 |
3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride (CAS 1173081-96-3) is a chemical compound with the molecular formula C8H13ClN2O and a molecular weight of 188.65 g/mol. IUPAC name: 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride. InChIKey: ZMDPNGUJHPRAMG-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O |
|---|---|
| Molecular weight | 188.65 g/mol |
| IUPAC name | 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride |
| InChIKey | ZMDPNGUJHPRAMG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)CN)C.Cl |
Computed by PubChem (NCBI)