cas: 1173081-96-3 — see every product listed under this CAS number, including other names
3-(Aminomethyl)-4,6-dimethylpyridin-2(1H)-one hydrochloride, 97%, 97% (CAS 1173081-96-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111E49-250mg |
| cas | 1173081-96-3 |
| size | 250mg |
| availability | 157.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 304.40 Pln | |
| Chemat | 100g | 909.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride (CAS 1173081-96-3) is a chemical compound with the molecular formula C8H13ClN2O and a molecular weight of 188.65 g/mol. IUPAC name: 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride. InChIKey: ZMDPNGUJHPRAMG-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O |
|---|---|
| Molecular weight | 188.65 g/mol |
| IUPAC name | 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride |
| InChIKey | ZMDPNGUJHPRAMG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)CN)C.Cl |
Computed by PubChem (NCBI)