cas: 630424-87-2 — see every product listed under this CAS number, including other names
3-(Difluoromethoxy)cinnamic acid, 95% (CAS 630424-87-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100mg, 250mg, 5g, 10g, 100g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A349761-1g |
| cas | 630424-87-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 2420.11 Pln | |
| AmBeed | 25g | 12868.66 Pln | |
| Fluorochem | 100mg | 180.16 Pln | |
| Fluorochem | 250mg | 211.40 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1216.26 Pln | |
| Fluorochem | 10g | 2012.85 Pln | |
| Fluorochem | 25g | 3923.64 Pln | |
| Fluorochem | 100g | 10134.99 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(E)-3-[3-(difluoromethoxy)phenyl]prop-2-enoic acid (CAS 630424-87-2) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: (E)-3-[3-(difluoromethoxy)phenyl]prop-2-enoic acid. InChIKey: YAXXERXTVQNNBQ-SNAWJCMRSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | (E)-3-[3-(difluoromethoxy)phenyl]prop-2-enoic acid |
| InChIKey | YAXXERXTVQNNBQ-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)