CAS 630424-87-2 is the registry number for 3-(Difluoromethoxy)cinnamic acid, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 25g, 100mg, 250mg, 5g, 10g, 100g.
(E)-3-[3-(difluoromethoxy)phenyl]prop-2-enoic acid (CAS 630424-87-2) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: (E)-3-[3-(difluoromethoxy)phenyl]prop-2-enoic acid. InChIKey: YAXXERXTVQNNBQ-SNAWJCMRSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | (E)-3-[3-(difluoromethoxy)phenyl]prop-2-enoic acid |
| InChIKey | YAXXERXTVQNNBQ-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)