cas: 50917-28-7 — see every product listed under this CAS number, including other names
3-Amino-2,4-dichlorobenzoic acid 98% (CAS 50917-28-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A680178-100mg |
| cas | 50917-28-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1171.38 Pln | |
| Ambeed | 5g | 4063.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A680178 |
3-amino-2,4-dichlorobenzoic acid (CAS 50917-28-7) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 3-amino-2,4-dichlorobenzoic acid. InChIKey: MWIWETSWQFRAPN-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 3-amino-2,4-dichlorobenzoic acid |
| InChIKey | MWIWETSWQFRAPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)N)Cl |
Computed by PubChem (NCBI)