cas: 682803-15-2 — see every product listed under this CAS number, including other names
3-Amino-2-(3,4-dichlorobenzyl)propanoic acid 95% (CAS 682803-15-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A439923-250mg |
| cas | 682803-15-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 765.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A439923 |
2-(aminomethyl)-3-(3,4-dichlorophenyl)propanoic acid (CAS 682803-15-2) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: 2-(aminomethyl)-3-(3,4-dichlorophenyl)propanoic acid. InChIKey: OWUCQTYNFQLYOY-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-(aminomethyl)-3-(3,4-dichlorophenyl)propanoic acid |
| InChIKey | OWUCQTYNFQLYOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(CN)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)