Products 211122-64-4
CAS 211122-64-4 is the registry number for tert-Butyl 3,6-dichloropyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 3,6-dichloropyridine-2-carboxylate (CAS 211122-64-4) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: tert-butyl 3,6-dichloropyridine-2-carboxylate. InChIKey: DFIOWYYDPDMCSE-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | tert-butyl 3,6-dichloropyridine-2-carboxylate |
| InChIKey | DFIOWYYDPDMCSE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=N1)Cl)Cl |
Computed by PubChem (NCBI)