cas: 60093-11-0 — see every product listed under this CAS number, including other names
3-Amino-5-benzylthio-1,2,4-thiadiazole (CAS 60093-11-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009663-100MG |
| cas | 60093-11-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 549.82 Pln | |
| Fluorochem | 250mg | 570.65 Pln | |
| Fluorochem | 500mg | 612.30 Pln | |
| Fluorochem | 1g | 633.13 Pln |
| delivery time | 2-3 weeks |
|---|
5-benzylsulfanyl-1,2,4-thiadiazol-3-amine (CAS 60093-11-0) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine. InChIKey: VTSHLDJUHMNAIL-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine |
| InChIKey | VTSHLDJUHMNAIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC(=NS2)N |
Computed by PubChem (NCBI)