CAS 88743-03-7 appears in our catalog under these names: 5-[(Phenylthio)methyl]-1,3,4-thiadiazol-2-amine, 95%, 5-((Phenylthio)methyl)-1,3,4-thiadiazol-2-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 5g, 1g.
5-(phenylsulfanylmethyl)-1,3,4-thiadiazol-2-amine (CAS 88743-03-7) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 5-(phenylsulfanylmethyl)-1,3,4-thiadiazol-2-amine. InChIKey: VRWRAXQYZVENLT-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 5-(phenylsulfanylmethyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | VRWRAXQYZVENLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SCC2=NN=C(S2)N |
Computed by PubChem (NCBI)