CAS 14731-25-0 appears in our catalog under these names: 5-P-Tolylamino-[1,3,4]thiadiazole-2-thiol, 95%, 5-(p-Tolylamino)-1,3,4-thiadiazole-2-thiol, 97%, 5-((4-Methylphenyl)amino)-1,3,4-thiadiazole-2-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
5-(4-methylanilino)-3H-1,3,4-thiadiazole-2-thione (CAS 14731-25-0) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 5-(4-methylanilino)-3H-1,3,4-thiadiazole-2-thione. InChIKey: UDHJCFUNVNFOLP-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 5-(4-methylanilino)-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | UDHJCFUNVNFOLP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=NNC(=S)S2 |
Computed by PubChem (NCBI)