Products 660417-22-1

CAS 660417-22-1 is the registry number for 4-Cyclopropyl-5-thien-2-yl-4h-1,2,4-triazole-3-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

4-cyclopropyl-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (CAS 660417-22-1) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 4-cyclopropyl-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione. InChIKey: XNQIVODBVLOPRU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9N3S2
Molecular weight223.3 g/mol
IUPAC name4-cyclopropyl-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione
InChIKeyXNQIVODBVLOPRU-UHFFFAOYSA-N
SMILESC1CC1N2C(=NNC2=S)C3=CC=CS3

Computed by PubChem (NCBI)