CAS 25660-71-3 appears in our catalog under these names: 2-Benzylthio-5-amino-1,3,4-thiadiazole, 98%, 2-Benzylthio-5-amino-1,3,4-thiadiazole, >95% (HPLC), 2–Amino–5–(benzylthio)–1,3,4–thiadiazole, 2-Amino-5-(benzylthio)-1,3,4-thiadiazole, >98.0%(HPLC)(T), 5-(Benzylthio)-1,3,4-thiadiazol-2-amine, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 200mg, 100mg.
5-benzylsulfanyl-1,3,4-thiadiazol-2-amine (CAS 25660-71-3) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 5-benzylsulfanyl-1,3,4-thiadiazol-2-amine. InChIKey: BHIGBGKIAJJBGD-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 5-benzylsulfanyl-1,3,4-thiadiazol-2-amine |
| InChIKey | BHIGBGKIAJJBGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NN=C(S2)N |
Computed by PubChem (NCBI)