CAS 60093-11-0 appears in our catalog under these names: 3-Amino-5-benzylthio-1,2,4-thiadiazole, 95%, 5-(Benzylthio)-1,2,4-thiadiazol-3-amine, 97%, 3-Amino-5-benzylthio-1,2,4-thiadiazole. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg.
5-benzylsulfanyl-1,2,4-thiadiazol-3-amine (CAS 60093-11-0) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine. InChIKey: VTSHLDJUHMNAIL-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine |
| InChIKey | VTSHLDJUHMNAIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC(=NS2)N |
Computed by PubChem (NCBI)