CAS 52494-32-3 appears in our catalog under these names: 5-M-Tolylamino-[1,3,4]thiadiazole-2-thiol, 95%, 5-(m-Tolylamino)-1,3,4-thiadiazole-2-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
5-(3-methylanilino)-3H-1,3,4-thiadiazole-2-thione (CAS 52494-32-3) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 5-(3-methylanilino)-3H-1,3,4-thiadiazole-2-thione. InChIKey: DRCBGFQZMQJJJL-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 5-(3-methylanilino)-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | DRCBGFQZMQJJJL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC2=NNC(=S)S2 |
Computed by PubChem (NCBI)