CAS 83757-08-8 is the registry number for 3-Benzylsulfanyl-[1,2,4]thiadiazol-5-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-benzylsulfanyl-1,2,4-thiadiazol-5-amine (CAS 83757-08-8) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 3-benzylsulfanyl-1,2,4-thiadiazol-5-amine. InChIKey: UOIUWIYFNWLYPM-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 3-benzylsulfanyl-1,2,4-thiadiazol-5-amine |
| InChIKey | UOIUWIYFNWLYPM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NSC(=N2)N |
Computed by PubChem (NCBI)