cas: 301220-81-5 — see every product listed under this CAS number, including other names
3-Benzyl-5-bromopyridine 97% (CAS 301220-81-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1255427-250mg |
| cas | 301220-81-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 2617.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1255427 |
3-benzyl-5-bromopyridine (CAS 301220-81-5) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 3-benzyl-5-bromopyridine. InChIKey: YKFQWSDTFGYJKJ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 3-benzyl-5-bromopyridine |
| InChIKey | YKFQWSDTFGYJKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)