cas: 301220-81-5 — see every product listed under this CAS number, including other names
3-Benzyl-5-bromopyridine (CAS 301220-81-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628581-1G |
| cas | 301220-81-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1388.07 Pln | |
| Fluorochem | 5g | 4027.77 Pln |
| delivery time | 3-4 weeks |
|---|
3-benzyl-5-bromopyridine (CAS 301220-81-5) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 3-benzyl-5-bromopyridine. InChIKey: YKFQWSDTFGYJKJ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 3-benzyl-5-bromopyridine |
| InChIKey | YKFQWSDTFGYJKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)