3-Borono-5-fluoro-4-methylbenzoic acid 97%
cas: 917223-87-1 — see every product listed under this CAS number, including other names
3-Borono-5-fluoro-4-methylbenzoic acid 97% (CAS 917223-87-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A389400-100mg |
| cas | 917223-87-1 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1405.00 Pln | |
| Ambeed | 5g | 4364.25 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A389400 |
3-borono-5-fluoro-4-methylbenzoic acid (CAS 917223-87-1) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: 3-borono-5-fluoro-4-methylbenzoic acid. InChIKey: KLHYMSYPRCYQQZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | 3-borono-5-fluoro-4-methylbenzoic acid |
| InChIKey | KLHYMSYPRCYQQZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1C)F)C(=O)O)(O)O |
Computed by PubChem (NCBI)