CAS 1315476-07-3 appears in our catalog under these names: 2-Fluoro-3-methoxycarbonylphenylboronic acid, 98%, 2-Fluoro-3-methoxycarbonylphenylboronic acid, >95% (HPLC), (2-Fluoro-3-(methoxycarbonyl)phenyl)boronic acid, 98%, (2-Fluoro-3-(methoxycarbonyl)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, TRC, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
(2-fluoro-3-methoxycarbonylphenyl)boronic acid (CAS 1315476-07-3) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: (2-fluoro-3-methoxycarbonylphenyl)boronic acid. InChIKey: ZWNQFICBQZRXEB-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | (2-fluoro-3-methoxycarbonylphenyl)boronic acid |
| InChIKey | ZWNQFICBQZRXEB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)