Products 2377611-41-9
CAS 2377611-41-9 appears in our catalog under these names: (2-Fluoro-3-formyl-6-methoxyphenyl)boronic acid, 95%, (2-Fluoro-3-formyl-6-methoxyphenyl)boronic acid, 98%, 2-Fluoro-3-formyl-6-methoxyphenylboronic acid, ≥95%, ≥95%, (2-Fluoro-3-formyl-6-methoxyphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g.
(2-fluoro-3-formyl-6-methoxyphenyl)boronic acid (CAS 2377611-41-9) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: (2-fluoro-3-formyl-6-methoxyphenyl)boronic acid. InChIKey: MUEZDTYAMBZQNF-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | (2-fluoro-3-formyl-6-methoxyphenyl)boronic acid |
| InChIKey | MUEZDTYAMBZQNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)C=O)OC)(O)O |
Computed by PubChem (NCBI)