Products 917223-87-1
CAS 917223-87-1 appears in our catalog under these names: 3-Borono-5-fluoro-4-methylbenzoic acid, 97%, 3–Borono–5–Fluoro–4–Methylbenzoic Acid, 3-Borono-5-fluoro-4-methylbenzoic acid 97%, 3-Borono-5-fluoro-4-methylbenzoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg.
3-borono-5-fluoro-4-methylbenzoic acid (CAS 917223-87-1) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: 3-borono-5-fluoro-4-methylbenzoic acid. InChIKey: KLHYMSYPRCYQQZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | 3-borono-5-fluoro-4-methylbenzoic acid |
| InChIKey | KLHYMSYPRCYQQZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1C)F)C(=O)O)(O)O |
Computed by PubChem (NCBI)