Products 2663787-27-5

CAS 2663787-27-5 is the registry number for 3-(Carboxymethyl)-2-fluorobenzeneboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-borono-2-fluorophenyl)acetic acid (CAS 2663787-27-5) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: 2-(3-borono-2-fluorophenyl)acetic acid. InChIKey: HXPJTAANQNFJLA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BFO4
Molecular weight197.96 g/mol
IUPAC name2-(3-borono-2-fluorophenyl)acetic acid
InChIKeyHXPJTAANQNFJLA-UHFFFAOYSA-N
SMILESB(C1=C(C(=CC=C1)CC(=O)O)F)(O)O

Computed by PubChem (NCBI)