Products 1072951-73-5
CAS 1072951-73-5 appears in our catalog under these names: 5-Fluoro-3-formyl-2-methoxyphenylboronic acid, 95%, (5-Fluoro-3-formyl-2-methoxyphenyl)boronic acid 95+%, 5-Fluoro-3-formyl-2-methoxyphenylboronic acid, 95+%, 95+%, (5-Fluoro-3-formyl-2-methoxyphenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(5-fluoro-3-formyl-2-methoxyphenyl)boronic acid (CAS 1072951-73-5) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: (5-fluoro-3-formyl-2-methoxyphenyl)boronic acid. InChIKey: NRUGZYHSZKKPJR-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | (5-fluoro-3-formyl-2-methoxyphenyl)boronic acid |
| InChIKey | NRUGZYHSZKKPJR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)C=O)F)(O)O |
Computed by PubChem (NCBI)