Products 1451392-14-5
CAS 1451392-14-5 appears in our catalog under these names: 3-Fluoro-2-formyl-6-methoxyphenylboronic acid, 95%, (3-Fluoro-2-formyl-6-methoxyphenyl)boronic acid, 98+%, 3-Fluoro-2-formyl-6-methoxyphenylboronic acid, ≥95%, ≥95%, 3-Fluoro-2-formyl-6-methoxyphenylboronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
(3-fluoro-2-formyl-6-methoxyphenyl)boronic acid (CAS 1451392-14-5) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: (3-fluoro-2-formyl-6-methoxyphenyl)boronic acid. InChIKey: NNUUKTREEYXKJL-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | (3-fluoro-2-formyl-6-methoxyphenyl)boronic acid |
| InChIKey | NNUUKTREEYXKJL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1C=O)F)OC)(O)O |
Computed by PubChem (NCBI)