CAS 1451392-03-2 appears in our catalog under these names: 3-Fluoro-2-formyl-4-methoxyphenylboronic acid, 95%, 3-Fluoro-2-formyl-4-methoxyphenylboronic acid, ≥95%, 3-Fluoro-2-formyl-4-methoxyphenylboronic acid, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
(3-fluoro-2-formyl-4-methoxyphenyl)boronic acid (CAS 1451392-03-2) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: (3-fluoro-2-formyl-4-methoxyphenyl)boronic acid. InChIKey: UJXWHOFERMURPA-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | (3-fluoro-2-formyl-4-methoxyphenyl)boronic acid |
| InChIKey | UJXWHOFERMURPA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC)F)C=O)(O)O |
Computed by PubChem (NCBI)