3-Borono-5-methylbenzoic acid, 98%
cas: 1150114-66-1 — see every product listed under this CAS number, including other names
3-Borono-5-methylbenzoic acid, 98% (CAS 1150114-66-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10g, 25g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A112233-250mg |
| cas | 1150114-66-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 10g | 4447.69 Pln | |
| Ambeed | 25g | 8814.25 Pln | |
| BLDpharm | 250mg | 397.66 Pln | |
| BLDpharm | 1g | 914.15 Pln | |
| BLDpharm | 5g | 2846.80 Pln | |
| BLDpharm | 10g | 4790.56 Pln | |
| BLDpharm | 25g | 9500.01 Pln | |
| Fluorochem | 250mg | 674.78 Pln | |
| Fluorochem | 1g | 1601.54 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
3-borono-5-methylbenzoic acid (CAS 1150114-66-1) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 3-borono-5-methylbenzoic acid. InChIKey: LGRLKFHVFRMHOZ-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 3-borono-5-methylbenzoic acid |
| InChIKey | LGRLKFHVFRMHOZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(=O)O)C)(O)O |
Computed by PubChem (NCBI)