3-Bromo-1,1':2',1''-terphenyl, 98%
cas: 1222633-95-5 — see every product listed under this CAS number, including other names
3-Bromo-1,1':2',1''-terphenyl, 98% (CAS 1222633-95-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1005070-250mg |
| cas | 1222633-95-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 765.31 Pln | |
| Ambeed | 10g | 1227.00 Pln | |
| Ambeed | 25g | 2389.56 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 319.91 Pln | |
| BLDpharm | 5g | 819.74 Pln | |
| BLDpharm | 10g | 1319.56 Pln | |
| BLDpharm | 25g | 2569.12 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 760.40 Pln | |
| Chemat | 10g | 1230.80 Pln | |
| Chemat | 25g | 2397.20 Pln | |
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 185.37 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-bromo-3-(2-phenylphenyl)benzene (CAS 1222633-95-5) is a chemical compound with the molecular formula C18H13Br and a molecular weight of 309.2 g/mol. IUPAC name: 1-bromo-3-(2-phenylphenyl)benzene. InChIKey: OONJSZCSHQXENF-UHFFFAOYSA-N.
| Molecular formula | C18H13Br |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 1-bromo-3-(2-phenylphenyl)benzene |
| InChIKey | OONJSZCSHQXENF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)
Synonyms:
1-bromo-3-(2-phenylphenyl)benzene