CAS 98905-03-4 appears in our catalog under these names: 3-Bromo-1,1':3',1''-terphenyl, 97%, 97%, 3-bromo-1,1':3',1''-terphenyl, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
1-bromo-3-(3-phenylphenyl)benzene (CAS 98905-03-4) is a chemical compound with the molecular formula C18H13Br and a molecular weight of 309.2 g/mol. IUPAC name: 1-bromo-3-(3-phenylphenyl)benzene. InChIKey: YDFHRBGWDLALOB-UHFFFAOYSA-N.
| Molecular formula | C18H13Br |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 1-bromo-3-(3-phenylphenyl)benzene |
| InChIKey | YDFHRBGWDLALOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)