CAS 1762-84-1 appears in our catalog under these names: 4–Bromo–p–terphenyl, 4-Bromo-p-terphenyl, >97.0%(GC), 4-Bromo-p-terphenyl 98%, 4-BROMO-P-TERPHENYL, 98%, 98%, 4-BROMO-P-TERPHENYL, 98%,. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100g, 250g, 500g.
1-bromo-4-(4-phenylphenyl)benzene (CAS 1762-84-1) is a chemical compound with the molecular formula C18H13Br and a molecular weight of 309.2 g/mol. IUPAC name: 1-bromo-4-(4-phenylphenyl)benzene. InChIKey: XNBGHWRYLJOQAU-UHFFFAOYSA-N.
| Molecular formula | C18H13Br |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 1-bromo-4-(4-phenylphenyl)benzene |
| InChIKey | XNBGHWRYLJOQAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)