CAS 24253-37-0 is the registry number for 4-Bromo-1,1':2',1''-terphenyl, 99%, 99%. Offered by: Chemat. Available pack sizes: 100mg.
1-bromo-4-(2-phenylphenyl)benzene (CAS 24253-37-0) is a chemical compound with the molecular formula C18H13Br and a molecular weight of 309.2 g/mol. IUPAC name: 1-bromo-4-(2-phenylphenyl)benzene. InChIKey: ALEDFYPQEIOLQU-UHFFFAOYSA-N.
| Molecular formula | C18H13Br |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 1-bromo-4-(2-phenylphenyl)benzene |
| InChIKey | ALEDFYPQEIOLQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)