CAS 60631-83-6 appears in our catalog under these names: 1-bromo-2,4-diphenyl-benzene, 97%, 97%, 4'-Bromo-1,1':3',1''-terphenyl, 99%(GC-MS),RG. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 500g.
1-bromo-2,4-diphenylbenzene (CAS 60631-83-6) is a chemical compound with the molecular formula C18H13Br and a molecular weight of 309.2 g/mol. IUPAC name: 1-bromo-2,4-diphenylbenzene. InChIKey: MMBYRANGXOOPII-UHFFFAOYSA-N.
| Molecular formula | C18H13Br |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 1-bromo-2,4-diphenylbenzene |
| InChIKey | MMBYRANGXOOPII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)