CAS 3282-24-4 appears in our catalog under these names: 2–Bromo–1,1':4',1''–terphenyl, 2''-Bromo-[1,1':4',1'']terphenyl, 95%, 2-Bromo-1,1':4',1''-terphenyl, >98.0%(GC), 2-Bromo-1,1':4',1''-terphenyl, ≥98%, ≥98%. Offered by: GLPBio, Combi-blocks, TCI, Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 50mg, 100mg, 200mg.
1-bromo-2-(4-phenylphenyl)benzene (CAS 3282-24-4) is a chemical compound with the molecular formula C18H13Br and a molecular weight of 309.2 g/mol. IUPAC name: 1-bromo-2-(4-phenylphenyl)benzene. InChIKey: RIPZAKKOEJWWQD-UHFFFAOYSA-N.
| Molecular formula | C18H13Br |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 1-bromo-2-(4-phenylphenyl)benzene |
| InChIKey | RIPZAKKOEJWWQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3Br |
Computed by PubChem (NCBI)