CAS 24253-40-5 appears in our catalog under these names: 4'-Bromo-1,1':2',1''-terphenyl, 98%, 4'-Bromo-1,1':2',1''-terphenyl, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g.
4-bromo-1,2-diphenylbenzene (CAS 24253-40-5) is a chemical compound with the molecular formula C18H13Br and a molecular weight of 309.2 g/mol. IUPAC name: 4-bromo-1,2-diphenylbenzene. InChIKey: PZRFVWIUESOINJ-UHFFFAOYSA-N.
| Molecular formula | C18H13Br |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 4-bromo-1,2-diphenylbenzene |
| InChIKey | PZRFVWIUESOINJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)