Products 75295-57-7

CAS 75295-57-7 is the registry number for 2-Bromo-1,1':2',1''-terphenyl, >97%, >97%. Offered by: Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 250mg.

Structural formula: {0} (CAS {1})

1-bromo-2-(2-phenylphenyl)benzene (CAS 75295-57-7) is a chemical compound with the molecular formula C18H13Br and a molecular weight of 309.2 g/mol. IUPAC name: 1-bromo-2-(2-phenylphenyl)benzene. InChIKey: YTLIDPYQVRVSCY-UHFFFAOYSA-N.

Identity
Molecular formulaC18H13Br
Molecular weight309.2 g/mol
IUPAC name1-bromo-2-(2-phenylphenyl)benzene
InChIKeyYTLIDPYQVRVSCY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=CC=C2C3=CC=CC=C3Br

Computed by PubChem (NCBI)